C19H20BrClN4O2S — CID 66542830
4-[[2-bromo-4-[(3-chlorophenyl)methoxy]-5-methoxyphenyl]methylamino]-3-ethyl-1H-1,2,4-triazole-5-thione (PubChem CID 66542830) has the molecular formula C19H20BrClN4O2S and a molecular weight of 483.82 g/mol. Its IUPAC name is 4-[[2-bromo-4-[(3-chlorophenyl)methoxy]-5-methoxyphenyl]methylamino]-3-ethyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[[2-bromo-4-[(3-chlorophenyl)methoxy]-5-methoxyphenyl]methylamino]-3-ethyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 66542830 |
| Molecular Formula | C19H20BrClN4O2S |
| Molecular Weight | 483.82 g/mol |
| Exact Mass | 482.02 |
| IUPAC Name | 4-[[2-bromo-4-[(3-chlorophenyl)methoxy]-5-methoxyphenyl]methylamino]-3-ethyl-1H-1,2,4-triazole-5-thione |
| SMILES | CCc1n[nH]c(=S)n1NCc1cc(OC)c(OCc2cccc(Cl)c2)cc1Br |
| InChI | InChI=1S/C19H20BrClN4O2S/c1-3-18-23-24-19(28)25(18)22-10-13-8-16(26-2)17(9-15(13)20)27-11-12-5-4-6-14(21)7-12/h4-9,22H,3,10-11H2,1-2H3,(H,24,28) |
| InChIKey | RFOVNQIGTGGRKX-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 64.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.82 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|