C18H18ClFN4OS — CID 4726248
4-[[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methylamino]-3-ethyl-1H-1,2,4-triazole-5-thione (PubChem CID 4726248) has the molecular formula C18H18ClFN4OS and a molecular weight of 392.89 g/mol. Its IUPAC name is 4-[[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methylamino]-3-ethyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methylamino]-3-ethyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 4726248 |
| Molecular Formula | C18H18ClFN4OS |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 4-[[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methylamino]-3-ethyl-1H-1,2,4-triazole-5-thione |
| SMILES | CCc1n[nH]c(=S)n1NCc1cc(Cl)ccc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C18H18ClFN4OS/c1-2-17-22-23-18(26)24(17)21-10-13-9-14(19)5-8-16(13)25-11-12-3-6-15(20)7-4-12/h3-9,21H,2,10-11H2,1H3,(H,23,26) |
| InChIKey | RKHMGADKQQRPDE-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 54.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|