C19H20ClFN4OS — CID 4725928
4-[[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methylamino]-3-propyl-1H-1,2,4-triazole-5-thione (PubChem CID 4725928) has the molecular formula C19H20ClFN4OS and a molecular weight of 406.91 g/mol. Its IUPAC name is 4-[[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methylamino]-3-propyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methylamino]-3-propyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 4725928 |
| Molecular Formula | C19H20ClFN4OS |
| Molecular Weight | 406.91 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 4-[[5-chloro-2-[(4-fluorophenyl)methoxy]phenyl]methylamino]-3-propyl-1H-1,2,4-triazole-5-thione |
| SMILES | CCCc1n[nH]c(=S)n1NCc1cc(Cl)ccc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C19H20ClFN4OS/c1-2-3-18-23-24-19(27)25(18)22-11-14-10-15(20)6-9-17(14)26-12-13-4-7-16(21)8-5-13/h4-10,22H,2-3,11-12H2,1H3,(H,24,27) |
| InChIKey | TZEQJHNJLLFOGU-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 54.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.91 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|