C19H19BrCl2N4OS — CID 4725899
4-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylamino]-3-propyl-1H-1,2,4-triazole-5-thione (PubChem CID 4725899) has the molecular formula C19H19BrCl2N4OS and a molecular weight of 502.27 g/mol. Its IUPAC name is 4-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylamino]-3-propyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylamino]-3-propyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 4725899 |
| Molecular Formula | C19H19BrCl2N4OS |
| Molecular Weight | 502.27 g/mol |
| Exact Mass | 499.98 |
| IUPAC Name | 4-[[5-bromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylamino]-3-propyl-1H-1,2,4-triazole-5-thione |
| SMILES | CCCc1n[nH]c(=S)n1NCc1cc(Br)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H19BrCl2N4OS/c1-2-3-18-24-25-19(28)26(18)23-10-13-8-14(20)5-7-17(13)27-11-12-4-6-15(21)9-16(12)22/h4-9,23H,2-3,10-11H2,1H3,(H,25,28) |
| InChIKey | LMYLQZGRTVSITR-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 54.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.27 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|