C19H20Cl2N4O2S — CID 4727726
4-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylamino]-3-methyl-1H-1,2,4-triazole-5-thione (PubChem CID 4727726) has the molecular formula C19H20Cl2N4O2S and a molecular weight of 439.37 g/mol. Its IUPAC name is 4-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylamino]-3-methyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylamino]-3-methyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 4727726 |
| Molecular Formula | C19H20Cl2N4O2S |
| Molecular Weight | 439.37 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | 4-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylamino]-3-methyl-1H-1,2,4-triazole-5-thione |
| SMILES | CCOc1cc(CNn2c(C)n[nH]c2=S)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H20Cl2N4O2S/c1-3-26-18-8-13(10-22-25-12(2)23-24-19(25)28)4-7-17(18)27-11-14-5-6-15(20)9-16(14)21/h4-9,22H,3,10-11H2,1-2H3,(H,24,28) |
| InChIKey | BKAIJFWNNXCNIZ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 64.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.37 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|