C18H18Cl2N4O2S — CID 4725577
4-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylamino]-3-methyl-1H-1,2,4-triazole-5-thione (PubChem CID 4725577) has the molecular formula C18H18Cl2N4O2S and a molecular weight of 425.34 g/mol. Its IUPAC name is 4-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylamino]-3-methyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylamino]-3-methyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 4725577 |
| Molecular Formula | C18H18Cl2N4O2S |
| Molecular Weight | 425.34 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | 4-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylamino]-3-methyl-1H-1,2,4-triazole-5-thione |
| SMILES | COc1cc(CNn2c(C)n[nH]c2=S)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H18Cl2N4O2S/c1-11-22-23-18(27)24(11)21-9-12-4-6-16(17(8-12)25-2)26-10-13-3-5-14(19)15(20)7-13/h3-8,21H,9-10H2,1-2H3,(H,23,27) |
| InChIKey | NGENHSMELZOIGZ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 64.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.34 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|