C17H17ClN4OS — CID 4727876
4-[[3-[(4-chlorophenyl)methoxy]phenyl]methylamino]-3-methyl-1H-1,2,4-triazole-5-thione (PubChem CID 4727876) has the molecular formula C17H17ClN4OS and a molecular weight of 360.87 g/mol. Its IUPAC name is 4-[[3-[(4-chlorophenyl)methoxy]phenyl]methylamino]-3-methyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[[3-[(4-chlorophenyl)methoxy]phenyl]methylamino]-3-methyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 4727876 |
| Molecular Formula | C17H17ClN4OS |
| Molecular Weight | 360.87 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 4-[[3-[(4-chlorophenyl)methoxy]phenyl]methylamino]-3-methyl-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1n[nH]c(=S)n1NCc1cccc(OCc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C17H17ClN4OS/c1-12-20-21-17(24)22(12)19-10-14-3-2-4-16(9-14)23-11-13-5-7-15(18)8-6-13/h2-9,19H,10-11H2,1H3,(H,21,24) |
| InChIKey | SLOAFGBOKDZAKP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 54.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.87 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|