C21H19N5OS — CID 4726490
4-[(3-phenylmethoxyphenyl)methylamino]-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione (PubChem CID 4726490) has the molecular formula C21H19N5OS and a molecular weight of 389.48 g/mol. Its IUPAC name is 4-[(3-phenylmethoxyphenyl)methylamino]-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(3-phenylmethoxyphenyl)methylamino]-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 4726490 |
| Molecular Formula | C21H19N5OS |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 4-[(3-phenylmethoxyphenyl)methylamino]-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(-c2ccncc2)n1NCc1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C21H19N5OS/c28-21-25-24-20(18-9-11-22-12-10-18)26(21)23-14-17-7-4-8-19(13-17)27-15-16-5-2-1-3-6-16/h1-13,23H,14-15H2,(H,25,28) |
| InChIKey | MDMRXLWQEZOTJZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|