C14H12N6O2S — CID 4726706
4-[(4-nitrophenyl)methylamino]-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione (PubChem CID 4726706) has the molecular formula C14H12N6O2S and a molecular weight of 328.36 g/mol. Its IUPAC name is 4-[(4-nitrophenyl)methylamino]-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(4-nitrophenyl)methylamino]-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 4726706 |
| Molecular Formula | C14H12N6O2S |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 4-[(4-nitrophenyl)methylamino]-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione |
| SMILES | O=[N+]([O-])c1ccc(CNn2c(-c3ccncc3)n[nH]c2=S)cc1 |
| InChI | InChI=1S/C14H12N6O2S/c21-20(22)12-3-1-10(2-4-12)9-16-19-13(17-18-14(19)23)11-5-7-15-8-6-11/h1-8,16H,9H2,(H,18,23) |
| InChIKey | XFBMVQFSQFQAGU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 101.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|