C23H23N5O2S — CID 4726462
4-[(3-ethoxy-4-phenylmethoxyphenyl)methylamino]-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione (PubChem CID 4726462) has the molecular formula C23H23N5O2S and a molecular weight of 433.54 g/mol. Its IUPAC name is 4-[(3-ethoxy-4-phenylmethoxyphenyl)methylamino]-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(3-ethoxy-4-phenylmethoxyphenyl)methylamino]-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 4726462 |
| Molecular Formula | C23H23N5O2S |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 4-[(3-ethoxy-4-phenylmethoxyphenyl)methylamino]-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione |
| SMILES | CCOc1cc(CNn2c(-c3ccncc3)n[nH]c2=S)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C23H23N5O2S/c1-2-29-21-14-18(8-9-20(21)30-16-17-6-4-3-5-7-17)15-25-28-22(26-27-23(28)31)19-10-12-24-13-11-19/h3-14,25H,2,15-16H2,1H3,(H,27,31) |
| InChIKey | MBXGOZWTSXZPPA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|