C18H19ClN6O3S — CID 4726575
2-[2-chloro-6-ethoxy-4-[[(3-pyridin-4-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)amino]methyl]phenoxy]acetamide (PubChem CID 4726575) has the molecular formula C18H19ClN6O3S and a molecular weight of 434.91 g/mol. Its IUPAC name is 2-[2-chloro-6-ethoxy-4-[[(3-pyridin-4-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)amino]methyl]phenoxy]acetamide.
| Compound Name | 2-[2-chloro-6-ethoxy-4-[[(3-pyridin-4-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)amino]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 4726575 |
| Molecular Formula | C18H19ClN6O3S |
| Molecular Weight | 434.91 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 2-[2-chloro-6-ethoxy-4-[[(3-pyridin-4-yl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)amino]methyl]phenoxy]acetamide |
| SMILES | CCOc1cc(CNn2c(-c3ccncc3)n[nH]c2=S)cc(Cl)c1OCC(N)=O |
| InChI | InChI=1S/C18H19ClN6O3S/c1-2-27-14-8-11(7-13(19)16(14)28-10-15(20)26)9-22-25-17(23-24-18(25)29)12-3-5-21-6-4-12/h3-8,22H,2,9-10H2,1H3,(H2,20,26)(H,24,29) |
| InChIKey | FYODQBRSKQDAGV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.91 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|