C23H22BrN5O2S — CID 66541583
4-[(2-bromo-5-ethoxy-4-phenylmethoxyphenyl)methylamino]-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione (PubChem CID 66541583) has the molecular formula C23H22BrN5O2S and a molecular weight of 512.43 g/mol. Its IUPAC name is 4-[(2-bromo-5-ethoxy-4-phenylmethoxyphenyl)methylamino]-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(2-bromo-5-ethoxy-4-phenylmethoxyphenyl)methylamino]-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 66541583 |
| Molecular Formula | C23H22BrN5O2S |
| Molecular Weight | 512.43 g/mol |
| Exact Mass | 511.07 |
| IUPAC Name | 4-[(2-bromo-5-ethoxy-4-phenylmethoxyphenyl)methylamino]-3-pyridin-4-yl-1H-1,2,4-triazole-5-thione |
| SMILES | CCOc1cc(CNn2c(-c3ccncc3)n[nH]c2=S)c(Br)cc1OCc1ccccc1 |
| InChI | InChI=1S/C23H22BrN5O2S/c1-2-30-20-12-18(19(24)13-21(20)31-15-16-6-4-3-5-7-16)14-26-29-22(27-28-23(29)32)17-8-10-25-11-9-17/h3-13,26H,2,14-15H2,1H3,(H,28,32) |
| InChIKey | ARCRTZHFXPWDNH-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.43 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|