C21H18Cl2N4OS — CID 4727714
4-[[2-[(2,4-dichlorophenyl)methoxy]naphthalen-1-yl]methylamino]-3-methyl-1H-1,2,4-triazole-5-thione (PubChem CID 4727714) has the molecular formula C21H18Cl2N4OS and a molecular weight of 445.38 g/mol. Its IUPAC name is 4-[[2-[(2,4-dichlorophenyl)methoxy]naphthalen-1-yl]methylamino]-3-methyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[[2-[(2,4-dichlorophenyl)methoxy]naphthalen-1-yl]methylamino]-3-methyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 4727714 |
| Molecular Formula | C21H18Cl2N4OS |
| Molecular Weight | 445.38 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 4-[[2-[(2,4-dichlorophenyl)methoxy]naphthalen-1-yl]methylamino]-3-methyl-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1n[nH]c(=S)n1NCc1c(OCc2ccc(Cl)cc2Cl)ccc2ccccc12 |
| InChI | InChI=1S/C21H18Cl2N4OS/c1-13-25-26-21(29)27(13)24-11-18-17-5-3-2-4-14(17)7-9-20(18)28-12-15-6-8-16(22)10-19(15)23/h2-10,24H,11-12H2,1H3,(H,26,29) |
| InChIKey | TXBJQJNOQFTYGT-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 54.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.38 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|