C26H21FN4OS — CID 4726101
4-[[2-[(2-fluorophenyl)methoxy]naphthalen-1-yl]methylamino]-3-phenyl-1H-1,2,4-triazole-5-thione (PubChem CID 4726101) has the molecular formula C26H21FN4OS and a molecular weight of 456.55 g/mol. Its IUPAC name is 4-[[2-[(2-fluorophenyl)methoxy]naphthalen-1-yl]methylamino]-3-phenyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[[2-[(2-fluorophenyl)methoxy]naphthalen-1-yl]methylamino]-3-phenyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 4726101 |
| Molecular Formula | C26H21FN4OS |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 4-[[2-[(2-fluorophenyl)methoxy]naphthalen-1-yl]methylamino]-3-phenyl-1H-1,2,4-triazole-5-thione |
| SMILES | Fc1ccccc1COc1ccc2ccccc2c1CNn1c(-c2ccccc2)n[nH]c1=S |
| InChI | InChI=1S/C26H21FN4OS/c27-23-13-7-5-11-20(23)17-32-24-15-14-18-8-4-6-12-21(18)22(24)16-28-31-25(29-30-26(31)33)19-9-2-1-3-10-19/h1-15,28H,16-17H2,(H,30,33) |
| InChIKey | GWDKFYXKENDWCE-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 54.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|