C21H23ClFNO — CID 17289991
N-[[2-[(2-fluorophenyl)methoxy]naphthalen-1-yl]methyl]propan-1-amine;hydrochloride (PubChem CID 17289991) has the molecular formula C21H23ClFNO and a molecular weight of 359.87 g/mol. Its IUPAC name is N-[[2-[(2-fluorophenyl)methoxy]naphthalen-1-yl]methyl]propan-1-amine;hydrochloride.
| Compound Name | N-[[2-[(2-fluorophenyl)methoxy]naphthalen-1-yl]methyl]propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17289991 |
| Molecular Formula | C21H23ClFNO |
| Molecular Weight | 359.87 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | N-[[2-[(2-fluorophenyl)methoxy]naphthalen-1-yl]methyl]propan-1-amine;hydrochloride |
| SMILES | CCCNCc1c(OCc2ccccc2F)ccc2ccccc12.Cl |
| InChI | InChI=1S/C21H22FNO.ClH/c1-2-13-23-14-19-18-9-5-3-7-16(18)11-12-21(19)24-15-17-8-4-6-10-20(17)22;/h3-12,23H,2,13-15H2,1H3;1H |
| InChIKey | KQZXTBCWHWODJS-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.87 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|