C26H25ClFN3O3 — CID 17291638
N-[[2-[(2-fluorophenyl)methoxy]naphthalen-1-yl]methyl]-N'-(4-nitrophenyl)ethane-1,2-diamine;hydrochloride (PubChem CID 17291638) has the molecular formula C26H25ClFN3O3 and a molecular weight of 481.96 g/mol. Its IUPAC name is N-[[2-[(2-fluorophenyl)methoxy]naphthalen-1-yl]methyl]-N'-(4-nitrophenyl)ethane-1,2-diamine;hydrochloride.
| Compound Name | N-[[2-[(2-fluorophenyl)methoxy]naphthalen-1-yl]methyl]-N'-(4-nitrophenyl)ethane-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 17291638 |
| Molecular Formula | C26H25ClFN3O3 |
| Molecular Weight | 481.96 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | N-[[2-[(2-fluorophenyl)methoxy]naphthalen-1-yl]methyl]-N'-(4-nitrophenyl)ethane-1,2-diamine;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccc(NCCNCc2c(OCc3ccccc3F)ccc3ccccc23)cc1 |
| InChI | InChI=1S/C26H24FN3O3.ClH/c27-25-8-4-2-6-20(25)18-33-26-14-9-19-5-1-3-7-23(19)24(26)17-28-15-16-29-21-10-12-22(13-11-21)30(31)32;/h1-14,28-29H,15-18H2;1H |
| InChIKey | CDHGCYYREOPWRH-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.96 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|