C14H18N2O3 — CID 79090223
N-[(2,3,4-trimethoxyphenyl)methyl]pyrrol-1-amine (PubChem CID 79090223) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is N-[(2,3,4-trimethoxyphenyl)methyl]pyrrol-1-amine.
| Compound Name | N-[(2,3,4-trimethoxyphenyl)methyl]pyrrol-1-amine |
|---|---|
| PubChem CID | 79090223 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N-[(2,3,4-trimethoxyphenyl)methyl]pyrrol-1-amine |
| SMILES | COc1ccc(CNn2cccc2)c(OC)c1OC |
| InChI | InChI=1S/C14H18N2O3/c1-17-12-7-6-11(13(18-2)14(12)19-3)10-15-16-8-4-5-9-16/h4-9,15H,10H2,1-3H3 |
| InChIKey | JDBPXLUCYRDQMT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 44.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |