C17H15BrCl2N4O2S — CID 66543999
4-[[6-bromo-2-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methylamino]-1H-1,2,4-triazole-5-thione (PubChem CID 66543999) has the molecular formula C17H15BrCl2N4O2S and a molecular weight of 490.21 g/mol. Its IUPAC name is 4-[[6-bromo-2-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methylamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[[6-bromo-2-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methylamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 66543999 |
| Molecular Formula | C17H15BrCl2N4O2S |
| Molecular Weight | 490.21 g/mol |
| Exact Mass | 487.95 |
| IUPAC Name | 4-[[6-bromo-2-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]methylamino]-1H-1,2,4-triazole-5-thione |
| SMILES | COc1ccc(Br)c(CNn2cn[nH]c2=S)c1OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H15BrCl2N4O2S/c1-25-15-6-5-12(18)10(7-22-24-9-21-23-17(24)27)16(15)26-8-11-13(19)3-2-4-14(11)20/h2-6,9,22H,7-8H2,1H3,(H,23,27) |
| InChIKey | XSWABKKEXIXFGQ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 64.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.21 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|