C17H17FN4O2S — CID 4727357
4-[[2-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylamino]-1H-1,2,4-triazole-5-thione (PubChem CID 4727357) has the molecular formula C17H17FN4O2S and a molecular weight of 360.41 g/mol. Its IUPAC name is 4-[[2-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[[2-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 4727357 |
| Molecular Formula | C17H17FN4O2S |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 4-[[2-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylamino]-1H-1,2,4-triazole-5-thione |
| SMILES | COc1cccc(CNn2cn[nH]c2=S)c1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C17H17FN4O2S/c1-23-15-4-2-3-13(9-20-22-11-19-21-17(22)25)16(15)24-10-12-5-7-14(18)8-6-12/h2-8,11,20H,9-10H2,1H3,(H,21,25) |
| InChIKey | BJOAUPTUHKOVLD-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 64.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|