C16H14BrFN4OS — CID 4727373
4-[[5-bromo-2-[(4-fluorophenyl)methoxy]phenyl]methylamino]-1H-1,2,4-triazole-5-thione (PubChem CID 4727373) has the molecular formula C16H14BrFN4OS and a molecular weight of 409.28 g/mol. Its IUPAC name is 4-[[5-bromo-2-[(4-fluorophenyl)methoxy]phenyl]methylamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[[5-bromo-2-[(4-fluorophenyl)methoxy]phenyl]methylamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 4727373 |
| Molecular Formula | C16H14BrFN4OS |
| Molecular Weight | 409.28 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | 4-[[5-bromo-2-[(4-fluorophenyl)methoxy]phenyl]methylamino]-1H-1,2,4-triazole-5-thione |
| SMILES | Fc1ccc(COc2ccc(Br)cc2CNn2cn[nH]c2=S)cc1 |
| InChI | InChI=1S/C16H14BrFN4OS/c17-13-3-6-15(23-9-11-1-4-14(18)5-2-11)12(7-13)8-20-22-10-19-21-16(22)24/h1-7,10,20H,8-9H2,(H,21,24) |
| InChIKey | PKCTUUJKPGNUON-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 54.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.28 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|