C20H23BrN6O4S — CID 66536349
N-[[6-bromo-3-methoxy-2-[(4-nitrophenyl)methoxy]phenyl]methyl]-3-(1-methyltetrazol-5-yl)sulfanylpropan-1-amine (PubChem CID 66536349) has the molecular formula C20H23BrN6O4S and a molecular weight of 523.41 g/mol. Its IUPAC name is N-[[6-bromo-3-methoxy-2-[(4-nitrophenyl)methoxy]phenyl]methyl]-3-(1-methyltetrazol-5-yl)sulfanylpropan-1-amine.
| Compound Name | N-[[6-bromo-3-methoxy-2-[(4-nitrophenyl)methoxy]phenyl]methyl]-3-(1-methyltetrazol-5-yl)sulfanylpropan-1-amine |
|---|---|
| PubChem CID | 66536349 |
| Molecular Formula | C20H23BrN6O4S |
| Molecular Weight | 523.41 g/mol |
| Exact Mass | 522.07 |
| IUPAC Name | N-[[6-bromo-3-methoxy-2-[(4-nitrophenyl)methoxy]phenyl]methyl]-3-(1-methyltetrazol-5-yl)sulfanylpropan-1-amine |
| SMILES | COc1ccc(Br)c(CNCCCSc2nnnn2C)c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H23BrN6O4S/c1-26-20(23-24-25-26)32-11-3-10-22-12-16-17(21)8-9-18(30-2)19(16)31-13-14-4-6-15(7-5-14)27(28)29/h4-9,22H,3,10-13H2,1-2H3 |
| InChIKey | STGVWODWFQQYOT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|