C16H24ClNO3 — CID 2990447
2-[(3-ethoxy-4-prop-2-ynoxyphenyl)methylamino]-2-methylpropan-1-ol;hydrochloride (PubChem CID 2990447) has the molecular formula C16H24ClNO3 and a molecular weight of 313.83 g/mol. Its IUPAC name is 2-[(3-ethoxy-4-prop-2-ynoxyphenyl)methylamino]-2-methylpropan-1-ol;hydrochloride.
| Compound Name | 2-[(3-ethoxy-4-prop-2-ynoxyphenyl)methylamino]-2-methylpropan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 2990447 |
| Molecular Formula | C16H24ClNO3 |
| Molecular Weight | 313.83 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 2-[(3-ethoxy-4-prop-2-ynoxyphenyl)methylamino]-2-methylpropan-1-ol;hydrochloride |
| SMILES | C#CCOc1ccc(CNC(C)(C)CO)cc1OCC.Cl |
| InChI | InChI=1S/C16H23NO3.ClH/c1-5-9-20-14-8-7-13(10-15(14)19-6-2)11-17-16(3,4)12-18;/h1,7-8,10,17-18H,6,9,11-12H2,2-4H3;1H |
| InChIKey | OPURMDVJWMULMZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.83 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|