C21H26ClNO3 — CID 51992922
N-[[4-[(3-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl]-1-[(2R)-oxolan-2-yl]methanamine (PubChem CID 51992922) has the molecular formula C21H26ClNO3 and a molecular weight of 375.90 g/mol. Its IUPAC name is N-[[4-[(3-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl]-1-[(2R)-oxolan-2-yl]methanamine.
| Compound Name | N-[[4-[(3-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl]-1-[(2R)-oxolan-2-yl]methanamine |
|---|---|
| PubChem CID | 51992922 |
| Molecular Formula | C21H26ClNO3 |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | N-[[4-[(3-chlorophenyl)methoxy]-3-ethoxyphenyl]methyl]-1-[(2R)-oxolan-2-yl]methanamine |
| SMILES | CCOc1cc(CNC[C@H]2CCCO2)ccc1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C21H26ClNO3/c1-2-24-21-12-16(13-23-14-19-7-4-10-25-19)8-9-20(21)26-15-17-5-3-6-18(22)11-17/h3,5-6,8-9,11-12,19,23H,2,4,7,10,13-15H2,1H3/t19-/m1/s1 |
| InChIKey | RBTATTXNRSIOES-LJQANCHMSA-N |
| XLogP | 4.59 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |