C15H20N4O5 — CID 2527547
[2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 4-(carbamoylamino)benzoate (PubChem CID 2527547) has the molecular formula C15H20N4O5 and a molecular weight of 336.35 g/mol. Its IUPAC name is [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 4-(carbamoylamino)benzoate.
| Compound Name | [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 4-(carbamoylamino)benzoate |
|---|---|
| PubChem CID | 2527547 |
| Molecular Formula | C15H20N4O5 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 4-(carbamoylamino)benzoate |
| SMILES | CC(C)CNC(=O)NC(=O)COC(=O)c1ccc(NC(N)=O)cc1 |
| InChI | InChI=1S/C15H20N4O5/c1-9(2)7-17-15(23)19-12(20)8-24-13(21)10-3-5-11(6-4-10)18-14(16)22/h3-6,9H,7-8H2,1-2H3,(H3,16,18,22)(H2,17,19,20,23) |
| InChIKey | OPZARUODVHVWNH-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 139.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |