C18H18ClN3O4 — CID 55321132
[2-[1-(4-chlorophenyl)ethylamino]-2-oxoethyl] 4-(carbamoylamino)benzoate (PubChem CID 55321132) has the molecular formula C18H18ClN3O4 and a molecular weight of 375.81 g/mol. Its IUPAC name is [2-[1-(4-chlorophenyl)ethylamino]-2-oxoethyl] 4-(carbamoylamino)benzoate.
| Compound Name | [2-[1-(4-chlorophenyl)ethylamino]-2-oxoethyl] 4-(carbamoylamino)benzoate |
|---|---|
| PubChem CID | 55321132 |
| Molecular Formula | C18H18ClN3O4 |
| Molecular Weight | 375.81 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | [2-[1-(4-chlorophenyl)ethylamino]-2-oxoethyl] 4-(carbamoylamino)benzoate |
| SMILES | CC(NC(=O)COC(=O)c1ccc(NC(N)=O)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H18ClN3O4/c1-11(12-2-6-14(19)7-3-12)21-16(23)10-26-17(24)13-4-8-15(9-5-13)22-18(20)25/h2-9,11H,10H2,1H3,(H,21,23)(H3,20,22,25) |
| InChIKey | JJYHZEUVTHUPQC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.81 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |