C18H27ClN2O5S — CID 2640683
[2-[[(2R)-3-methylbutan-2-yl]amino]-2-oxoethyl] 4-chloro-3-(diethylsulfamoyl)benzoate (PubChem CID 2640683) has the molecular formula C18H27ClN2O5S and a molecular weight of 418.94 g/mol. Its IUPAC name is [2-[[(2R)-3-methylbutan-2-yl]amino]-2-oxoethyl] 4-chloro-3-(diethylsulfamoyl)benzoate.
| Compound Name | [2-[[(2R)-3-methylbutan-2-yl]amino]-2-oxoethyl] 4-chloro-3-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2640683 |
| Molecular Formula | C18H27ClN2O5S |
| Molecular Weight | 418.94 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | [2-[[(2R)-3-methylbutan-2-yl]amino]-2-oxoethyl] 4-chloro-3-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)OCC(=O)N[C@H](C)C(C)C)ccc1Cl |
| InChI | InChI=1S/C18H27ClN2O5S/c1-6-21(7-2)27(24,25)16-10-14(8-9-15(16)19)18(23)26-11-17(22)20-13(5)12(3)4/h8-10,12-13H,6-7,11H2,1-5H3,(H,20,22)/t13-/m1/s1 |
| InChIKey | HDFHQRHABIBLEF-CYBMUJFWSA-N |
| XLogP | 2.69 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.94 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |