C17H24N2O6 — CID 2591432
[2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 3,4-dimethoxybenzoate (PubChem CID 2591432) has the molecular formula C17H24N2O6 and a molecular weight of 352.39 g/mol. Its IUPAC name is [2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 3,4-dimethoxybenzoate.
| Compound Name | [2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 3,4-dimethoxybenzoate |
|---|---|
| PubChem CID | 2591432 |
| Molecular Formula | C17H24N2O6 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | [2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 3,4-dimethoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)NC(=O)NCCC(C)C)cc1OC |
| InChI | InChI=1S/C17H24N2O6/c1-11(2)7-8-18-17(22)19-15(20)10-25-16(21)12-5-6-13(23-3)14(9-12)24-4/h5-6,9,11H,7-8,10H2,1-4H3,(H2,18,19,20,22) |
| InChIKey | ZOQBEGQCSYYACY-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |