C17H24N2O6 — CID 8904897
[2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 2-(4-methoxyphenoxy)acetate (PubChem CID 8904897) has the molecular formula C17H24N2O6 and a molecular weight of 352.39 g/mol. Its IUPAC name is [2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 2-(4-methoxyphenoxy)acetate.
| Compound Name | [2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 2-(4-methoxyphenoxy)acetate |
|---|---|
| PubChem CID | 8904897 |
| Molecular Formula | C17H24N2O6 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | [2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 2-(4-methoxyphenoxy)acetate |
| SMILES | COc1ccc(OCC(=O)OCC(=O)NC(=O)NCCC(C)C)cc1 |
| InChI | InChI=1S/C17H24N2O6/c1-12(2)8-9-18-17(22)19-15(20)10-25-16(21)11-24-14-6-4-13(23-3)5-7-14/h4-7,12H,8-11H2,1-3H3,(H2,18,19,20,22) |
| InChIKey | KSLULEUGEAFKKV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |