C22H27N3O5 — CID 7149570
[2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 2-(4-anilinophenoxy)acetate (PubChem CID 7149570) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is [2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 2-(4-anilinophenoxy)acetate.
| Compound Name | [2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 2-(4-anilinophenoxy)acetate |
|---|---|
| PubChem CID | 7149570 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | [2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 2-(4-anilinophenoxy)acetate |
| SMILES | CC(C)CCNC(=O)NC(=O)COC(=O)COc1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C22H27N3O5/c1-16(2)12-13-23-22(28)25-20(26)14-30-21(27)15-29-19-10-8-18(9-11-19)24-17-6-4-3-5-7-17/h3-11,16,24H,12-15H2,1-2H3,(H2,23,25,26,28) |
| InChIKey | RJZCIQVWEJJAFY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |