C16H21FN2O4 — CID 2544607
[2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 2-(2-fluorophenyl)acetate (PubChem CID 2544607) has the molecular formula C16H21FN2O4 and a molecular weight of 324.35 g/mol. Its IUPAC name is [2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 2-(2-fluorophenyl)acetate.
| Compound Name | [2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 2-(2-fluorophenyl)acetate |
|---|---|
| PubChem CID | 2544607 |
| Molecular Formula | C16H21FN2O4 |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | [2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 2-(2-fluorophenyl)acetate |
| SMILES | CC(C)CCNC(=O)NC(=O)COC(=O)Cc1ccccc1F |
| InChI | InChI=1S/C16H21FN2O4/c1-11(2)7-8-18-16(22)19-14(20)10-23-15(21)9-12-5-3-4-6-13(12)17/h3-6,11H,7-10H2,1-2H3,(H2,18,19,20,22) |
| InChIKey | QFGZPLYMMCQCST-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |