C18H26N2O5 — CID 8007989
[2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 3-(4-methoxyphenyl)propanoate (PubChem CID 8007989) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is [2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 3-(4-methoxyphenyl)propanoate.
| Compound Name | [2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 3-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 8007989 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | [2-(3-methylbutylcarbamoylamino)-2-oxoethyl] 3-(4-methoxyphenyl)propanoate |
| SMILES | COc1ccc(CCC(=O)OCC(=O)NC(=O)NCCC(C)C)cc1 |
| InChI | InChI=1S/C18H26N2O5/c1-13(2)10-11-19-18(23)20-16(21)12-25-17(22)9-6-14-4-7-15(24-3)8-5-14/h4-5,7-8,13H,6,9-12H2,1-3H3,(H2,19,20,21,23) |
| InChIKey | RKRIFRSQDWZAML-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |