C15H19FN2O4 — CID 8553142
[2-oxo-2-(propylcarbamoylamino)ethyl] 3-(4-fluorophenyl)propanoate (PubChem CID 8553142) has the molecular formula C15H19FN2O4 and a molecular weight of 310.33 g/mol. Its IUPAC name is [2-oxo-2-(propylcarbamoylamino)ethyl] 3-(4-fluorophenyl)propanoate.
| Compound Name | [2-oxo-2-(propylcarbamoylamino)ethyl] 3-(4-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 8553142 |
| Molecular Formula | C15H19FN2O4 |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | [2-oxo-2-(propylcarbamoylamino)ethyl] 3-(4-fluorophenyl)propanoate |
| SMILES | CCCNC(=O)NC(=O)COC(=O)CCc1ccc(F)cc1 |
| InChI | InChI=1S/C15H19FN2O4/c1-2-9-17-15(21)18-13(19)10-22-14(20)8-5-11-3-6-12(16)7-4-11/h3-4,6-7H,2,5,8-10H2,1H3,(H2,17,18,19,21) |
| InChIKey | KHEJVWWKXRVPHN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |