C17H17N3O5 — CID 2609306
[2-(carbamoylamino)-2-oxoethyl] 2-(4-anilinophenoxy)acetate (PubChem CID 2609306) has the molecular formula C17H17N3O5 and a molecular weight of 343.34 g/mol. Its IUPAC name is [2-(carbamoylamino)-2-oxoethyl] 2-(4-anilinophenoxy)acetate.
| Compound Name | [2-(carbamoylamino)-2-oxoethyl] 2-(4-anilinophenoxy)acetate |
|---|---|
| PubChem CID | 2609306 |
| Molecular Formula | C17H17N3O5 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | [2-(carbamoylamino)-2-oxoethyl] 2-(4-anilinophenoxy)acetate |
| SMILES | NC(=O)NC(=O)COC(=O)COc1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C17H17N3O5/c18-17(23)20-15(21)10-25-16(22)11-24-14-8-6-13(7-9-14)19-12-4-2-1-3-5-12/h1-9,19H,10-11H2,(H3,18,20,21,23) |
| InChIKey | PCIQPFAXKRTGBN-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |