C21H24N2O4 — CID 2556596
(2-oxo-2-piperidin-1-ylethyl) 2-(4-anilinophenoxy)acetate (PubChem CID 2556596) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is (2-oxo-2-piperidin-1-ylethyl) 2-(4-anilinophenoxy)acetate.
| Compound Name | (2-oxo-2-piperidin-1-ylethyl) 2-(4-anilinophenoxy)acetate |
|---|---|
| PubChem CID | 2556596 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | (2-oxo-2-piperidin-1-ylethyl) 2-(4-anilinophenoxy)acetate |
| SMILES | O=C(COc1ccc(Nc2ccccc2)cc1)OCC(=O)N1CCCCC1 |
| InChI | InChI=1S/C21H24N2O4/c24-20(23-13-5-2-6-14-23)15-27-21(25)16-26-19-11-9-18(10-12-19)22-17-7-3-1-4-8-17/h1,3-4,7-12,22H,2,5-6,13-16H2 |
| InChIKey | SWWRKTDGMCXULS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |