C16H20N2O5 — CID 7980424
[2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl] 2-phenoxyacetate (PubChem CID 7980424) has the molecular formula C16H20N2O5 and a molecular weight of 320.34 g/mol. Its IUPAC name is [2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl] 2-phenoxyacetate.
| Compound Name | [2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl] 2-phenoxyacetate |
|---|---|
| PubChem CID | 7980424 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | [2-(4-carbamoylpiperidin-1-yl)-2-oxoethyl] 2-phenoxyacetate |
| SMILES | NC(=O)C1CCN(C(=O)COC(=O)COc2ccccc2)CC1 |
| InChI | InChI=1S/C16H20N2O5/c17-16(21)12-6-8-18(9-7-12)14(19)10-23-15(20)11-22-13-4-2-1-3-5-13/h1-5,12H,6-11H2,(H2,17,21) |
| InChIKey | DCTIAGJLLVIPRL-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |