C16H19BrN2O5 — CID 9018061
[2-[(3S)-3-carbamoylpiperidin-1-yl]-2-oxoethyl] 2-(3-bromophenoxy)acetate (PubChem CID 9018061) has the molecular formula C16H19BrN2O5 and a molecular weight of 399.24 g/mol. Its IUPAC name is [2-[(3S)-3-carbamoylpiperidin-1-yl]-2-oxoethyl] 2-(3-bromophenoxy)acetate.
| Compound Name | [2-[(3S)-3-carbamoylpiperidin-1-yl]-2-oxoethyl] 2-(3-bromophenoxy)acetate |
|---|---|
| PubChem CID | 9018061 |
| Molecular Formula | C16H19BrN2O5 |
| Molecular Weight | 399.24 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | [2-[(3S)-3-carbamoylpiperidin-1-yl]-2-oxoethyl] 2-(3-bromophenoxy)acetate |
| SMILES | NC(=O)[C@H]1CCCN(C(=O)COC(=O)COc2cccc(Br)c2)C1 |
| InChI | InChI=1S/C16H19BrN2O5/c17-12-4-1-5-13(7-12)23-10-15(21)24-9-14(20)19-6-2-3-11(8-19)16(18)22/h1,4-5,7,11H,2-3,6,8-10H2,(H2,18,22)/t11-/m0/s1 |
| InChIKey | MNHDBAZOHNCYDQ-NSHDSACASA-N |
| XLogP | 1.10 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.24 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |