C20H23N5O5S — CID 55453529
(4-aminoquinazolin-2-yl)methyl 5-(dimethylsulfamoyl)-2-(2-hydroxyethylamino)benzoate (PubChem CID 55453529) has the molecular formula C20H23N5O5S and a molecular weight of 445.50 g/mol. Its IUPAC name is (4-aminoquinazolin-2-yl)methyl 5-(dimethylsulfamoyl)-2-(2-hydroxyethylamino)benzoate.
| Compound Name | (4-aminoquinazolin-2-yl)methyl 5-(dimethylsulfamoyl)-2-(2-hydroxyethylamino)benzoate |
|---|---|
| PubChem CID | 55453529 |
| Molecular Formula | C20H23N5O5S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | (4-aminoquinazolin-2-yl)methyl 5-(dimethylsulfamoyl)-2-(2-hydroxyethylamino)benzoate |
| SMILES | CN(C)S(=O)(=O)c1ccc(NCCO)c(C(=O)OCc2nc(N)c3ccccc3n2)c1 |
| InChI | InChI=1S/C20H23N5O5S/c1-25(2)31(28,29)13-7-8-16(22-9-10-26)15(11-13)20(27)30-12-18-23-17-6-4-3-5-14(17)19(21)24-18/h3-8,11,22,26H,9-10,12H2,1-2H3,(H2,21,23,24) |
| InChIKey | UDSFHNWNEFQQAB-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 147.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |