C18H28N4O7S — CID 55425029
[2-(butylcarbamoylamino)-2-oxoethyl] 5-(dimethylsulfamoyl)-2-(2-hydroxyethylamino)benzoate (PubChem CID 55425029) has the molecular formula C18H28N4O7S and a molecular weight of 444.51 g/mol. Its IUPAC name is [2-(butylcarbamoylamino)-2-oxoethyl] 5-(dimethylsulfamoyl)-2-(2-hydroxyethylamino)benzoate.
| Compound Name | [2-(butylcarbamoylamino)-2-oxoethyl] 5-(dimethylsulfamoyl)-2-(2-hydroxyethylamino)benzoate |
|---|---|
| PubChem CID | 55425029 |
| Molecular Formula | C18H28N4O7S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | [2-(butylcarbamoylamino)-2-oxoethyl] 5-(dimethylsulfamoyl)-2-(2-hydroxyethylamino)benzoate |
| SMILES | CCCCNC(=O)NC(=O)COC(=O)c1cc(S(=O)(=O)N(C)C)ccc1NCCO |
| InChI | InChI=1S/C18H28N4O7S/c1-4-5-8-20-18(26)21-16(24)12-29-17(25)14-11-13(30(27,28)22(2)3)6-7-15(14)19-9-10-23/h6-7,11,19,23H,4-5,8-10,12H2,1-3H3,(H2,20,21,24,26) |
| InChIKey | BMPBJEISHSDOPG-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 154.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|