C16H22ClN3O6S — CID 7878775
[2-[[(2S)-butan-2-yl]carbamoylamino]-2-oxoethyl] 2-chloro-5-(dimethylsulfamoyl)benzoate (PubChem CID 7878775) has the molecular formula C16H22ClN3O6S and a molecular weight of 419.89 g/mol. Its IUPAC name is [2-[[(2S)-butan-2-yl]carbamoylamino]-2-oxoethyl] 2-chloro-5-(dimethylsulfamoyl)benzoate.
| Compound Name | [2-[[(2S)-butan-2-yl]carbamoylamino]-2-oxoethyl] 2-chloro-5-(dimethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 7878775 |
| Molecular Formula | C16H22ClN3O6S |
| Molecular Weight | 419.89 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | [2-[[(2S)-butan-2-yl]carbamoylamino]-2-oxoethyl] 2-chloro-5-(dimethylsulfamoyl)benzoate |
| SMILES | CC[C@H](C)NC(=O)NC(=O)COC(=O)c1cc(S(=O)(=O)N(C)C)ccc1Cl |
| InChI | InChI=1S/C16H22ClN3O6S/c1-5-10(2)18-16(23)19-14(21)9-26-15(22)12-8-11(6-7-13(12)17)27(24,25)20(3)4/h6-8,10H,5,9H2,1-4H3,(H2,18,19,21,23)/t10-/m0/s1 |
| InChIKey | QTOWHDRACWCMAS-JTQLQIEISA-N |
| XLogP | 1.37 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.89 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |