C19H28N4O4S — CID 9086541
(3R)-3-N-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]piperidine-1,3-dicarboxamide (PubChem CID 9086541) has the molecular formula C19H28N4O4S and a molecular weight of 408.52 g/mol. Its IUPAC name is (3R)-3-N-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]piperidine-1,3-dicarboxamide.
| Compound Name | (3R)-3-N-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 9086541 |
| Molecular Formula | C19H28N4O4S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | (3R)-3-N-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]piperidine-1,3-dicarboxamide |
| SMILES | CC1CCN(S(=O)(=O)c2ccc(NC(=O)[C@@H]3CCCN(C(N)=O)C3)cc2)CC1 |
| InChI | InChI=1S/C19H28N4O4S/c1-14-8-11-23(12-9-14)28(26,27)17-6-4-16(5-7-17)21-18(24)15-3-2-10-22(13-15)19(20)25/h4-7,14-15H,2-3,8-13H2,1H3,(H2,20,25)(H,21,24)/t15-/m1/s1 |
| InChIKey | RBBGCOOBFDIBIP-OAHLLOKOSA-N |
| XLogP | 1.84 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |