C20H22ClN3O5S — CID 51961591
ethyl 4-[(3S)-3-[(5-chloro-2-pyridinyl)carbamoyl]piperidin-1-yl]sulfonylbenzoate (PubChem CID 51961591) has the molecular formula C20H22ClN3O5S and a molecular weight of 451.93 g/mol. Its IUPAC name is ethyl 4-[(3S)-3-[(5-chloro-2-pyridinyl)carbamoyl]piperidin-1-yl]sulfonylbenzoate.
| Compound Name | ethyl 4-[(3S)-3-[(5-chloro-2-pyridinyl)carbamoyl]piperidin-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 51961591 |
| Molecular Formula | C20H22ClN3O5S |
| Molecular Weight | 451.93 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | ethyl 4-[(3S)-3-[(5-chloro-2-pyridinyl)carbamoyl]piperidin-1-yl]sulfonylbenzoate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)N2CCC[C@H](C(=O)Nc3ccc(Cl)cn3)C2)cc1 |
| InChI | InChI=1S/C20H22ClN3O5S/c1-2-29-20(26)14-5-8-17(9-6-14)30(27,28)24-11-3-4-15(13-24)19(25)23-18-10-7-16(21)12-22-18/h5-10,12,15H,2-4,11,13H2,1H3,(H,22,23,25)/t15-/m0/s1 |
| InChIKey | OTLAQQHOMCVOBD-HNNXBMFYSA-N |
| XLogP | 2.95 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.93 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |