C18H20BrN3O3S — CID 26028129
(3R)-1-(4-bromophenyl)sulfonyl-N-(5-methyl-2-pyridinyl)piperidine-3-carboxamide (PubChem CID 26028129) has the molecular formula C18H20BrN3O3S and a molecular weight of 438.35 g/mol. Its IUPAC name is (3R)-1-(4-bromophenyl)sulfonyl-N-(5-methyl-2-pyridinyl)piperidine-3-carboxamide.
| Compound Name | (3R)-1-(4-bromophenyl)sulfonyl-N-(5-methyl-2-pyridinyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 26028129 |
| Molecular Formula | C18H20BrN3O3S |
| Molecular Weight | 438.35 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | (3R)-1-(4-bromophenyl)sulfonyl-N-(5-methyl-2-pyridinyl)piperidine-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)[C@@H]2CCCN(S(=O)(=O)c3ccc(Br)cc3)C2)nc1 |
| InChI | InChI=1S/C18H20BrN3O3S/c1-13-4-9-17(20-11-13)21-18(23)14-3-2-10-22(12-14)26(24,25)16-7-5-15(19)6-8-16/h4-9,11,14H,2-3,10,12H2,1H3,(H,20,21,23)/t14-/m1/s1 |
| InChIKey | JFILGWWWWHPFHZ-CQSZACIVSA-N |
| XLogP | 3.19 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |