C22H25FN2O5S — CID 133168230
ethyl 4-[[1-(4-fluorophenyl)sulfonylpiperidine-3-carbonyl]amino]-3-methylbenzoate (PubChem CID 133168230) has the molecular formula C22H25FN2O5S and a molecular weight of 448.52 g/mol. Its IUPAC name is ethyl 4-[[1-(4-fluorophenyl)sulfonylpiperidine-3-carbonyl]amino]-3-methylbenzoate.
| Compound Name | ethyl 4-[[1-(4-fluorophenyl)sulfonylpiperidine-3-carbonyl]amino]-3-methylbenzoate |
|---|---|
| PubChem CID | 133168230 |
| Molecular Formula | C22H25FN2O5S |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | ethyl 4-[[1-(4-fluorophenyl)sulfonylpiperidine-3-carbonyl]amino]-3-methylbenzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C2CCCN(S(=O)(=O)c3ccc(F)cc3)C2)c(C)c1 |
| InChI | InChI=1S/C22H25FN2O5S/c1-3-30-22(27)16-6-11-20(15(2)13-16)24-21(26)17-5-4-12-25(14-17)31(28,29)19-9-7-18(23)8-10-19/h6-11,13,17H,3-5,12,14H2,1-2H3,(H,24,26) |
| InChIKey | IAUPRTIVNJEEEK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |