C22H25FN2O5S — CID 46616093
propyl 4-[[1-(4-fluorophenyl)sulfonylpiperidine-3-carbonyl]amino]benzoate (PubChem CID 46616093) has the molecular formula C22H25FN2O5S and a molecular weight of 448.52 g/mol. Its IUPAC name is propyl 4-[[1-(4-fluorophenyl)sulfonylpiperidine-3-carbonyl]amino]benzoate.
| Compound Name | propyl 4-[[1-(4-fluorophenyl)sulfonylpiperidine-3-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 46616093 |
| Molecular Formula | C22H25FN2O5S |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | propyl 4-[[1-(4-fluorophenyl)sulfonylpiperidine-3-carbonyl]amino]benzoate |
| SMILES | CCCOC(=O)c1ccc(NC(=O)C2CCCN(S(=O)(=O)c3ccc(F)cc3)C2)cc1 |
| InChI | InChI=1S/C22H25FN2O5S/c1-2-14-30-22(27)16-5-9-19(10-6-16)24-21(26)17-4-3-13-25(15-17)31(28,29)20-11-7-18(23)8-12-20/h5-12,17H,2-4,13-15H2,1H3,(H,24,26) |
| InChIKey | HBGKUUXRSXNLSC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |