C16H22FN3O2 — CID 113008251
4-N-(3-fluorophenyl)-1-N-propan-2-ylpiperidine-1,4-dicarboxamide (PubChem CID 113008251) has the molecular formula C16H22FN3O2 and a molecular weight of 307.37 g/mol. Its IUPAC name is 4-N-(3-fluorophenyl)-1-N-propan-2-ylpiperidine-1,4-dicarboxamide.
| Compound Name | 4-N-(3-fluorophenyl)-1-N-propan-2-ylpiperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 113008251 |
| Molecular Formula | C16H22FN3O2 |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 4-N-(3-fluorophenyl)-1-N-propan-2-ylpiperidine-1,4-dicarboxamide |
| SMILES | CC(C)NC(=O)N1CCC(C(=O)Nc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C16H22FN3O2/c1-11(2)18-16(22)20-8-6-12(7-9-20)15(21)19-14-5-3-4-13(17)10-14/h3-5,10-12H,6-9H2,1-2H3,(H,18,22)(H,19,21) |
| InChIKey | QBJDFRMLBVWFNR-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |