C14H12ClN3O3 — CID 94182414
(3S)-3-(2-chlorophenyl)-3-(pyrazine-2-carbonylamino)propanoic acid (PubChem CID 94182414) has the molecular formula C14H12ClN3O3 and a molecular weight of 305.72 g/mol. Its IUPAC name is (3S)-3-(2-chlorophenyl)-3-(pyrazine-2-carbonylamino)propanoic acid.
| Compound Name | (3S)-3-(2-chlorophenyl)-3-(pyrazine-2-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 94182414 |
| Molecular Formula | C14H12ClN3O3 |
| Molecular Weight | 305.72 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | (3S)-3-(2-chlorophenyl)-3-(pyrazine-2-carbonylamino)propanoic acid |
| SMILES | O=C(O)C[C@H](NC(=O)c1cnccn1)c1ccccc1Cl |
| InChI | InChI=1S/C14H12ClN3O3/c15-10-4-2-1-3-9(10)11(7-13(19)20)18-14(21)12-8-16-5-6-17-12/h1-6,8,11H,7H2,(H,18,21)(H,19,20)/t11-/m0/s1 |
| InChIKey | OGNBARHGQVMGGX-NSHDSACASA-N |
| XLogP | 2.08 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.72 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |