C13H10N2OS — CID 574246
N-[4-(cyanomethyl)phenyl]thiophene-2-carboxamide (PubChem CID 574246) has the molecular formula C13H10N2OS and a molecular weight of 242.30 g/mol. Its IUPAC name is N-[4-(cyanomethyl)phenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-(cyanomethyl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 574246 |
| Molecular Formula | C13H10N2OS |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | N-[4-(cyanomethyl)phenyl]thiophene-2-carboxamide |
| SMILES | N#CCc1ccc(NC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C13H10N2OS/c14-8-7-10-3-5-11(6-4-10)15-13(16)12-2-1-9-17-12/h1-6,9H,7H2,(H,15,16) |
| InChIKey | REVMSZSIYLWEFH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |