C16H18N2O2S3 — CID 75463880
N-(thian-4-ylmethyl)-2-(thiophene-2-carbonylamino)thiophene-3-carboxamide (PubChem CID 75463880) has the molecular formula C16H18N2O2S3 and a molecular weight of 366.53 g/mol. Its IUPAC name is N-(thian-4-ylmethyl)-2-(thiophene-2-carbonylamino)thiophene-3-carboxamide.
| Compound Name | N-(thian-4-ylmethyl)-2-(thiophene-2-carbonylamino)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 75463880 |
| Molecular Formula | C16H18N2O2S3 |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | N-(thian-4-ylmethyl)-2-(thiophene-2-carbonylamino)thiophene-3-carboxamide |
| SMILES | O=C(Nc1sccc1C(=O)NCC1CCSCC1)c1cccs1 |
| InChI | InChI=1S/C16H18N2O2S3/c19-14(17-10-11-3-7-21-8-4-11)12-5-9-23-16(12)18-15(20)13-2-1-6-22-13/h1-2,5-6,9,11H,3-4,7-8,10H2,(H,17,19)(H,18,20) |
| InChIKey | WVBXBCDCIJLIIV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |