C14H21N3O3S — CID 63114438
2-[(1-propan-2-ylpyrrolidin-3-yl)methylcarbamoylamino]thiophene-3-carboxylic acid (PubChem CID 63114438) has the molecular formula C14H21N3O3S and a molecular weight of 311.41 g/mol. Its IUPAC name is 2-[(1-propan-2-ylpyrrolidin-3-yl)methylcarbamoylamino]thiophene-3-carboxylic acid.
| Compound Name | 2-[(1-propan-2-ylpyrrolidin-3-yl)methylcarbamoylamino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 63114438 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 2-[(1-propan-2-ylpyrrolidin-3-yl)methylcarbamoylamino]thiophene-3-carboxylic acid |
| SMILES | CC(C)N1CCC(CNC(=O)Nc2sccc2C(=O)O)C1 |
| InChI | InChI=1S/C14H21N3O3S/c1-9(2)17-5-3-10(8-17)7-15-14(20)16-12-11(13(18)19)4-6-21-12/h4,6,9-10H,3,5,7-8H2,1-2H3,(H,18,19)(H2,15,16,20) |
| InChIKey | SBRKZNMRHRFSKG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |