C15H22N2O3 — CID 114344239
2,3-dihydroxy-N-[(1-propan-2-ylpyrrolidin-3-yl)methyl]benzamide (PubChem CID 114344239) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 2,3-dihydroxy-N-[(1-propan-2-ylpyrrolidin-3-yl)methyl]benzamide.
| Compound Name | 2,3-dihydroxy-N-[(1-propan-2-ylpyrrolidin-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 114344239 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 2,3-dihydroxy-N-[(1-propan-2-ylpyrrolidin-3-yl)methyl]benzamide |
| SMILES | CC(C)N1CCC(CNC(=O)c2cccc(O)c2O)C1 |
| InChI | InChI=1S/C15H22N2O3/c1-10(2)17-7-6-11(9-17)8-16-15(20)12-4-3-5-13(18)14(12)19/h3-5,10-11,18-19H,6-9H2,1-2H3,(H,16,20) |
| InChIKey | JPERRBXACLJBTN-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|